| Name |
3-amino-4-(2H-1,2,3-triazol-2-yl)benzoic acid
|
| Molecular Formula |
C9H8N4O2
|
| Molecular Weight |
204.19
|
| Smiles |
Nc1cc(C(=O)O)ccc1-n1nccn1
|
Nc1cc(C(=O)O)ccc1-n1nccn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.