| Name |
O-Ethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) hydrogen phosphorothioate
|
| Molecular Formula |
C10H12N3O3PS
|
| Molecular Weight |
285.26
|
| Smiles |
CCOP(O)(=S)Oc1ncn(-c2ccccc2)n1
|
CCOP(O)(=S)Oc1ncn(-c2ccccc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.