| Name |
2H-3,1-Benzoxazine-2,4(1H)-dione, 8-bromo-5-methyl-
|
| Molecular Formula |
C9H6BrNO3
|
| Molecular Weight |
256.05
|
| Smiles |
Cc1ccc(Br)c2[nH]c(=O)oc(=O)c12
|
Cc1ccc(Br)c2[nH]c(=O)oc(=O)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.