| Name |
2,2',2",5'-Tetramethyl-[1,1':4',1"-terphenyl]-4,4"-dicarboxylic acid
|
| Molecular Formula |
C24H22O4
|
| Molecular Weight |
374.4
|
| Smiles |
Cc1cc(C(=O)O)ccc1-c1cc(C)c(-c2ccc(C(=O)O)cc2C)cc1C
|
Cc1cc(C(=O)O)ccc1-c1cc(C)c(-c2ccc(C(=O)O)cc2C)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.