| Name |
5-tert-butoxycarbonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-2-carboxylic acid
|
| Molecular Formula |
C12H20N2O4
|
| Molecular Weight |
256.30
|
| Smiles |
CC(C)(C)OC(=O)N1CC2CC(C(=O)O)NC2C1
|
CC(C)(C)OC(=O)N1CC2CC(C(=O)O)NC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.