| Name |
Tert-butyl 2-(3,4-dihydro-6-(2,4-dimethoxyphenyl)-4-oxo-2-thioxopyrimidin-1(2h)-yl)acetate
|
| Molecular Formula |
C18H22N2O5S
|
| Molecular Weight |
378.4
|
| Smiles |
COc1ccc(-c2cc(=O)[nH]c(=S)n2CC(=O)OC(C)(C)C)c(OC)c1
|
COc1ccc(-c2cc(=O)[nH]c(=S)n2CC(=O)OC(C)(C)C)c(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.