| Name |
[5-(4-Nitro-phenyl)-[1,3,4]oxadiazol-2-ylmethyl]-carbamic acid tert-butyl ester
|
| Molecular Formula |
C14H16N4O5
|
| Molecular Weight |
320.30
|
| Smiles |
CC(C)(C)OC(=O)NCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1
|
CC(C)(C)OC(=O)NCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.