| Name |
N-(2-Methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)prop-2-enamide
|
| Molecular Formula |
C10H14N4O
|
| Molecular Weight |
206.24
|
| Smiles |
C=CC(=O)NC1CCc2nc(C)nn2C1
|
C=CC(=O)NC1CCc2nc(C)nn2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.