| Name |
Benzenepropanoic acid, 3-(2,5-dihydro-5-oxo-1H-1,2,4-triazol-3-yl)-
|
| Molecular Formula |
C11H11N3O3
|
| Molecular Weight |
233.22
|
| Smiles |
O=C(O)CCc1cccc(-c2n[nH]c(=O)[nH]2)c1
|
O=C(O)CCc1cccc(-c2n[nH]c(=O)[nH]2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.