| Name |
7-ethyl-2-methoxy-4H,5H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one
|
| Molecular Formula |
C8H10N4O2
|
| Molecular Weight |
194.19
|
| Smiles |
CCc1cc(=O)[nH]c2nc(OC)nn12
|
CCc1cc(=O)[nH]c2nc(OC)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.