| Name | 1-(Oxolan-3-yl)-4-[2-(trifluoromethyl)benzoyl]-1,4-diazepane | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C17H21F3N2O2 | 
                        
                        
                            | Molecular Weight | 342.36 | 
                        
                        
                            | Smiles | O=C(c1ccccc1C(F)(F)F)N1CCCN(C2CCOC2)CC1 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        O=C(c1ccccc1C(F)(F)F)N1CCCN(C2CCOC2)CC1
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.