| Name |
2-(2-ethyl-5-oxo-5,6-dihydro-4H-imidazo[1,2-b][1,2,4]triazol-6-yl)-N-[2-(trifluoromethyl)phenyl]acetamide
|
| Molecular Formula |
C15H14F3N5O2
|
| Molecular Weight |
353.30
|
| Smiles |
CCc1nc2n(n1)C(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)N2
|
CCc1nc2n(n1)C(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.