| Name |
N-(3-chloro-4-fluorophenyl)-2-(5-oxo-2-phenyl-5,6-dihydro-4H-imidazo[1,2-b][1,2,4]triazol-6-yl)acetamide
|
| Molecular Formula |
C18H13ClFN5O2
|
| Molecular Weight |
385.8
|
| Smiles |
O=C(CC1C(=O)Nc2nc(-c3ccccc3)nn21)Nc1ccc(F)c(Cl)c1
|
O=C(CC1C(=O)Nc2nc(-c3ccccc3)nn21)Nc1ccc(F)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.