| Name |
3-(4-((2,4-Dichlorobenzyl)oxy)phenyl)-1,6-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione
|
| Molecular Formula |
C20H15Cl2N5O3
|
| Molecular Weight |
444.3
|
| Smiles |
Cn1nc(-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)nc2c(=O)n(C)c(=O)nc1-2
|
Cn1nc(-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)nc2c(=O)n(C)c(=O)nc1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.