| Name |
2-Quinolineacetic acid, I+/--amino-7-bromo-, (I+/-R)-
|
| Molecular Formula |
C11H9BrN2O2
|
| Molecular Weight |
281.10
|
| Smiles |
NC(C(=O)O)c1ccc2ccc(Br)cc2n1
|
NC(C(=O)O)c1ccc2ccc(Br)cc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.