| Name |
Lithium;5-(difluoromethyl)-1,3-thiazole-2-carboxylate
|
| Molecular Formula |
C5H2F2LiNO2S
|
| Molecular Weight |
185.1
|
| Smiles |
O=C([O-])c1ncc(C(F)F)s1.[Li+]
|
O=C([O-])c1ncc(C(F)F)s1.[Li+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.