| Name |
2-(1,1-Dichloroethyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazole
|
| Molecular Formula |
C8H12Cl2N2O
|
| Molecular Weight |
223.10
|
| Smiles |
CC(C)(C)c1nnc(C(C)(Cl)Cl)o1
|
CC(C)(C)c1nnc(C(C)(Cl)Cl)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.