| Name |
2,3-Dihydro-2-phenyl-5H-1,2,3-triazolo[4,5-b]pyridin-5-one
|
| Molecular Formula |
C11H8N4O
|
| Molecular Weight |
212.21
|
| Smiles |
O=c1ccc2nn(-c3ccccc3)nc2[nH]1
|
O=c1ccc2nn(-c3ccccc3)nc2[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.