| Name |
11-(Trifluoromethyl)-1,8,10,12-tetraazatricyclo[7.3.0.0,2,6]dodeca-9,11-diene
|
| Molecular Formula |
C9H11F3N4
|
| Molecular Weight |
232.21
|
| Smiles |
FC(F)(F)c1nc2n(n1)C1CCCC1CN2
|
FC(F)(F)c1nc2n(n1)C1CCCC1CN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.