| Name |
4H-[1,4]Diazepino[5',6':4,5]thieno[3,2-f]quinoline-3,8-dione, 9,10,11,12-tetrahydro-10-methyl-, (10S)-
|
| Molecular Formula |
C15H13N3O2S
|
| Molecular Weight |
299.3
|
| Smiles |
CC1CNc2c(sc3ccc4[nH]c(=O)ccc4c23)C(=O)N1
|
CC1CNc2c(sc3ccc4[nH]c(=O)ccc4c23)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.