| Name |
7-(3,4-Dichlorophenyl)-5-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydrotetraazolo[1,5-a]pyrimidine
|
| Molecular Formula |
C18H17Cl2N5O2
|
| Molecular Weight |
406.3
|
| Smiles |
COc1ccc(C2CC(c3ccc(Cl)c(Cl)c3)n3nnnc3N2)cc1OC
|
COc1ccc(C2CC(c3ccc(Cl)c(Cl)c3)n3nnnc3N2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.