| Name |
3-(2-Hydroxy-4,6-dimethylphenyl)-5-(2-hydroxyethyl)-4-(3-methoxyphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one
|
| Molecular Formula |
C22H27N3O4
|
| Molecular Weight |
397.5
|
| Smiles |
COc1cccc(C2C3C(NNC3c3c(C)cc(C)cc3O)C(=O)N2CCO)c1
|
COc1cccc(C2C3C(NNC3c3c(C)cc(C)cc3O)C(=O)N2CCO)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.