| Name |
4'-Methyl-3'-oxaspiro[azetidine-3,2'-bicyclo[2.1.1]hexane]-1'-carbonitrile
|
| Molecular Formula |
C9H12N2O
|
| Molecular Weight |
164.20
|
| Smiles |
CC12CC(C#N)(C1)C1(CNC1)O2
|
CC12CC(C#N)(C1)C1(CNC1)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.