| Name |
4-(1,3-benzothiazol-2-yl)-5-imino-1-(3,4,5-trifluorophenyl)-2,5-dihydro-1H-pyrrol-3-ol
|
| Molecular Formula |
C17H10F3N3OS
|
| Molecular Weight |
361.3
|
| Smiles |
N=C1C(c2nc3ccccc3s2)=C(O)CN1c1cc(F)c(F)c(F)c1
|
N=C1C(c2nc3ccccc3s2)=C(O)CN1c1cc(F)c(F)c(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.