| Name |
1-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexyl)phenyl]-1H-pyrrole-2,5-dione
|
| Molecular Formula |
C16H6F13NO2
|
| Molecular Weight |
491.20
|
| Smiles |
O=C1C=CC(=O)N1c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1
|
O=C1C=CC(=O)N1c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.