| Name |
2-{[1-ethyl-6-(4-fluorobenzyl)-3-methyl-7-oxo-6,7-dihydro-1H-pyrazolo[4,3-d]pyrimidin-5-yl]sulfanyl}-N~1~-phenylacetamide
|
| Molecular Formula |
C23H22FN5O2S
|
| Molecular Weight |
451.5
|
| Smiles |
CCn1nc(C)c2nc(SCC(=O)Nc3ccccc3)n(Cc3ccc(F)cc3)c(=O)c21
|
CCn1nc(C)c2nc(SCC(=O)Nc3ccccc3)n(Cc3ccc(F)cc3)c(=O)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.