| Name |
2-({1-ethyl-6-[(3-methoxyphenyl)methyl]-3-methyl-7-oxo-1H,6H,7H-pyrazolo[4,3-d]pyrimidin-5-yl}sulfanyl)-N-(2-fluorophenyl)acetamide
|
| Molecular Formula |
C24H24FN5O3S
|
| Molecular Weight |
481.5
|
| Smiles |
CCn1nc(C)c2nc(SCC(=O)Nc3ccccc3F)n(Cc3cccc(OC)c3)c(=O)c21
|
CCn1nc(C)c2nc(SCC(=O)Nc3ccccc3F)n(Cc3cccc(OC)c3)c(=O)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.