| Name |
1-({2-[(3,5-dimethylphenyl)amino]-2-oxoethyl}thio)-4-isobutyl-N-isopropyl-5-oxo-4,5-dihydro[1,2,4]triazolo[4,3-a]quinazoline-8-carboxamide
|
| Molecular Formula |
C27H32N6O3S
|
| Molecular Weight |
520.6
|
| Smiles |
Cc1cc(C)cc(NC(=O)CSc2nnc3n(CC(C)C)c(=O)c4ccc(C(=O)NC(C)C)cc4n23)c1
|
Cc1cc(C)cc(NC(=O)CSc2nnc3n(CC(C)C)c(=O)c4ccc(C(=O)NC(C)C)cc4n23)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.