| Name |
3-benzyl-2-((2-(3,4-dimethoxyphenyl)-2-oxoethyl)thio)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one
|
| Molecular Formula |
C26H21N3O4S2
|
| Molecular Weight |
503.6
|
| Smiles |
COc1ccc(C(=O)CSc2nc3c(sc4ncccc43)c(=O)n2Cc2ccccc2)cc1OC
|
COc1ccc(C(=O)CSc2nc3c(sc4ncccc43)c(=O)n2Cc2ccccc2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.