| Name |
6-{[(6-chloro-4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl}-4-methyl-2H-1,4-benzoxazin-3(4H)-one
|
| Molecular Formula |
C21H16ClNO6
|
| Molecular Weight |
413.8
|
| Smiles |
Cc1cc(=O)oc2cc(OCC(=O)c3ccc4c(c3)N(C)C(=O)CO4)c(Cl)cc12
|
Cc1cc(=O)oc2cc(OCC(=O)c3ccc4c(c3)N(C)C(=O)CO4)c(Cl)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.