| Name |
3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-amine nitrate
|
| Molecular Formula |
C9H11N5O4
|
| Molecular Weight |
253.22
|
| Smiles |
COc1ccc(-c2nc(N)n[nH]2)cc1.O=[N+]([O-])O
|
COc1ccc(-c2nc(N)n[nH]2)cc1.O=[N+]([O-])O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.