| Name |
5,5 inverted exclamation mark-[[Methylenebis(4,1-phenylene)]bis(oxy)]bis(isobenzofuran-1,3-dione)
|
| Molecular Formula |
C29H16O8
|
| Molecular Weight |
492.4
|
| Smiles |
O=C1OC(=O)c2cc(Oc3ccc(Cc4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)cc3)ccc21
|
O=C1OC(=O)c2cc(Oc3ccc(Cc4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)cc3)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.