| Name |
1,5,7,11-Tetrahydro-15H-5,11[5',6']-Endo-benzimidazoanthra[2,3-d:6,7-d']diimidazole
|
| Molecular Formula |
C23H14N6
|
| Molecular Weight |
374.4
|
| Smiles |
c1nc2cc3c(cc2[nH]1)C1c2cc4[nH]cnc4cc2C3c2cc3nc[nH]c3cc21
|
c1nc2cc3c(cc2[nH]1)C1c2cc4[nH]cnc4cc2C3c2cc3nc[nH]c3cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.