| Name |
3-(4-butyl-5-oxo-4,5-dihydrothieno[2,3-e][1,2,4]triazolo[4,3-a]pyrimidin-1-yl)-N-(3,4-dimethoxyphenyl)propanamide
|
| Molecular Formula |
C22H25N5O4S
|
| Molecular Weight |
455.5
|
| Smiles |
CCCCn1c(=O)c2sccc2n2c(CCC(=O)Nc3ccc(OC)c(OC)c3)nnc12
|
CCCCn1c(=O)c2sccc2n2c(CCC(=O)Nc3ccc(OC)c(OC)c3)nnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.