| Name |
1-(3,4-Dichlorophenyl)-2-[2,3-dihydro-2-imino-3-[(4-methylphenyl)methyl]-1H-benzimidazol-1-yl]ethanone Hydrobromide
|
| Molecular Formula |
C23H20BrCl2N3O
|
| Molecular Weight |
505.2
|
| Smiles |
Br.Cc1ccc(Cn2c(=N)n(CC(=O)c3ccc(Cl)c(Cl)c3)c3ccccc32)cc1
|
Br.Cc1ccc(Cn2c(=N)n(CC(=O)c3ccc(Cl)c(Cl)c3)c3ccccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.