| Name |
6-(tert-butyl)-6,7,8,9-tetrahydro-5H-pyrido[3,4-b]indole
|
| Molecular Formula |
C15H20N2
|
| Molecular Weight |
228.33
|
| Smiles |
CC(C)(C)C1CCc2[nH]c3cnccc3c2C1
|
CC(C)(C)C1CCc2[nH]c3cnccc3c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.