| Name |
7-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-5-sulfonamide
|
| Molecular Formula |
C7H8ClN3O4S2
|
| Molecular Weight |
297.7
|
| Smiles |
NS(=O)(=O)c1cc(Cl)cc2c1NCNS2(=O)=O
|
NS(=O)(=O)c1cc(Cl)cc2c1NCNS2(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.