| Name |
rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (2R,4R)-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)oxane-2-carboxylate
|
| Molecular Formula |
C29H24N2O7
|
| Molecular Weight |
512.5
|
| Smiles |
O=C(NC1CCOC(C(=O)ON2C(=O)c3ccccc3C2=O)C1)OCC1c2ccccc2-c2ccccc21
|
O=C(NC1CCOC(C(=O)ON2C(=O)c3ccccc3C2=O)C1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.