| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 5-(4-chlorophenyl)-1,3-thiazole-2-carboxylate
|
| Molecular Formula |
C18H9ClN2O4S
|
| Molecular Weight |
384.8
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)c1ncc(-c2ccc(Cl)cc2)s1
|
O=C(ON1C(=O)c2ccccc2C1=O)c1ncc(-c2ccc(Cl)cc2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.