| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-[(4,6-dioxo-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl)oxy]acetate
|
| Molecular Formula |
C13H8N4O7
|
| Molecular Weight |
332.22
|
| Smiles |
O=C(COc1nc(=O)[nH]c(=O)[nH]1)ON1C(=O)c2ccccc2C1=O
|
O=C(COc1nc(=O)[nH]c(=O)[nH]1)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.