| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-2-methylbutanoate
|
| Molecular Formula |
C29H26N2O6
|
| Molecular Weight |
498.5
|
| Smiles |
CCC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)c2ccccc2C1=O
|
CCC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.