| Name |
5-Formyl-6-(2,2,2-trifluoroacetamido)pyridine-3-carboxylic acid
|
| Molecular Formula |
C9H5F3N2O4
|
| Molecular Weight |
262.14
|
| Smiles |
O=Cc1cc(C(=O)O)cnc1NC(=O)C(F)(F)F
|
O=Cc1cc(C(=O)O)cnc1NC(=O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.