| Name |
rac-2-(2-{[(1R,2S)-2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]cyclopentyl]formamido}acetamido)acetic acid
|
| Molecular Formula |
C26H29N3O6
|
| Molecular Weight |
479.5
|
| Smiles |
O=C(O)CNC(=O)CNC(=O)C1CCCC1CNC(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)CNC(=O)CNC(=O)C1CCCC1CNC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.