| Name |
rac-3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 1-(9H-fluoren-9-yl)methyl (3R,4S)-4-(1,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-1,3-dicarboxylate
|
| Molecular Formula |
C33H28N4O6
|
| Molecular Weight |
576.6
|
| Smiles |
Cc1c(C2CN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2C(=O)ON2C(=O)c3ccccc3C2=O)cnn1C
|
Cc1c(C2CN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2C(=O)ON2C(=O)c3ccccc3C2=O)cnn1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.