| Name |
6-Bromo-4-ethyl-2,7-dimethylquinoline
|
| Molecular Formula |
C13H14BrN
|
| Molecular Weight |
264.16
|
| Smiles |
CCc1cc(C)nc2cc(C)c(Br)cc12
|
CCc1cc(C)nc2cc(C)c(Br)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.