| Name |
5-Amino-2-(2,6-dimethoxybenzyl)-2,4-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
|
| Molecular Formula |
C14H15N5O3
|
| Molecular Weight |
301.30
|
| Smiles |
COc1cccc(OC)c1Cn1cc2nc(N)[nH]c(=O)c2n1
|
COc1cccc(OC)c1Cn1cc2nc(N)[nH]c(=O)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.