| Name |
6-(2-amino-1,1-difluoroethyl)-2,3-difluoro-N,N-dimethylaniline
|
| Molecular Formula |
C10H12F4N2
|
| Molecular Weight |
236.21
|
| Smiles |
CN(C)c1c(C(F)(F)CN)ccc(F)c1F
|
CN(C)c1c(C(F)(F)CN)ccc(F)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.