| Name |
Benzene, 1,1'-methylenebis[4-nitro-, ion(1-)
|
| Molecular Formula |
C13H9N2O4-
|
| Molecular Weight |
257.22
|
| Smiles |
O=[N+]([O-])c1ccc(C=C2C=C[C-]([N+](=O)[O-])C=C2)cc1
|
O=[N+]([O-])c1ccc(C=C2C=C[C-]([N+](=O)[O-])C=C2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.