| Name |
4-[(5-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylcyclohexyl)({[(9H-fluoren-9-yl)methoxy]carbonyl})amino]butanoic acid
|
| Molecular Formula |
C32H42N2O6
|
| Molecular Weight |
550.7
|
| Smiles |
CC1(C)CC(NC(=O)OC(C)(C)C)CC(N(CCCC(=O)O)C(=O)OCC2c3ccccc3-c3ccccc32)C1
|
CC1(C)CC(NC(=O)OC(C)(C)C)CC(N(CCCC(=O)O)C(=O)OCC2c3ccccc3-c3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.