| Name |
2-[N-cyclopentyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-methylpentanamido]acetic acid
|
| Molecular Formula |
C28H34N2O5
|
| Molecular Weight |
478.6
|
| Smiles |
CC(C)C(CC(=O)N(CC(=O)O)C1CCCC1)NC(=O)OCC1c2ccccc2-c2ccccc21
|
CC(C)C(CC(=O)N(CC(=O)O)C1CCCC1)NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.